C23H27NO4S — CID 46910421
(2R,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-hydroxy-2-phenylmethoxyhexan-1-one (PubChem CID 46910421) has the molecular formula C23H27NO4S and a molecular weight of 413.54 g/mol. Its IUPAC name is (2R,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-hydroxy-2-phenylmethoxyhexan-1-one.
| Compound Name | (2R,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-hydroxy-2-phenylmethoxyhexan-1-one |
|---|---|
| PubChem CID | 46910421 |
| Molecular Formula | C23H27NO4S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | (2R,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-hydroxy-2-phenylmethoxyhexan-1-one |
| SMILES | CCC[C@@H](O)[C@@H](OCc1ccccc1)C(=O)N1C(=S)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C23H27NO4S/c1-2-9-20(25)21(27-15-18-12-7-4-8-13-18)22(26)24-19(16-28-23(24)29)14-17-10-5-3-6-11-17/h3-8,10-13,19-21,25H,2,9,14-16H2,1H3/t19-,20+,21+/m0/s1 |
| InChIKey | GOSBFKUEGSTEOX-PWRODBHTSA-N |
| XLogP | 3.49 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|