C17H21NO4S — CID 11209867
(2R,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-hydroxy-2-prop-2-enoxybutan-1-one (PubChem CID 11209867) has the molecular formula C17H21NO4S and a molecular weight of 335.43 g/mol. Its IUPAC name is (2R,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-hydroxy-2-prop-2-enoxybutan-1-one.
| Compound Name | (2R,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-hydroxy-2-prop-2-enoxybutan-1-one |
|---|---|
| PubChem CID | 11209867 |
| Molecular Formula | C17H21NO4S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | (2R,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-hydroxy-2-prop-2-enoxybutan-1-one |
| SMILES | C=CCO[C@@H](C(=O)N1C(=S)OC[C@@H]1Cc1ccccc1)[C@@H](C)O |
| InChI | InChI=1S/C17H21NO4S/c1-3-9-21-15(12(2)19)16(20)18-14(11-22-17(18)23)10-13-7-5-4-6-8-13/h3-8,12,14-15,19H,1,9-11H2,2H3/t12-,14+,15-/m1/s1 |
| InChIKey | WZBSXQXLCREMPS-VHDGCEQUSA-N |
| XLogP | 1.69 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|