C16H18FNO4 — CID 138733878
(4S)-4-benzyl-3-(2-fluoro-3-hydroxy-2-methylpent-4-enoyl)-1,3-oxazolidin-2-one (PubChem CID 138733878) has the molecular formula C16H18FNO4 and a molecular weight of 307.32 g/mol. Its IUPAC name is (4S)-4-benzyl-3-(2-fluoro-3-hydroxy-2-methylpent-4-enoyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-(2-fluoro-3-hydroxy-2-methylpent-4-enoyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 138733878 |
| Molecular Formula | C16H18FNO4 |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (4S)-4-benzyl-3-(2-fluoro-3-hydroxy-2-methylpent-4-enoyl)-1,3-oxazolidin-2-one |
| SMILES | C=CC(O)C(C)(F)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C16H18FNO4/c1-3-13(19)16(2,17)14(20)18-12(10-22-15(18)21)9-11-7-5-4-6-8-11/h3-8,12-13,19H,1,9-10H2,2H3/t12-,13?,16?/m0/s1 |
| InChIKey | BWLXVVRLQANOFI-FUJMWEONSA-N |
| XLogP | 1.85 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|