C21H25NO5 — CID 102342660
(2R,3R)-N-methoxy-N-methyl-4-oxo-2,3-bis(phenylmethoxy)pentanamide (PubChem CID 102342660) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is (2R,3R)-N-methoxy-N-methyl-4-oxo-2,3-bis(phenylmethoxy)pentanamide.
| Compound Name | (2R,3R)-N-methoxy-N-methyl-4-oxo-2,3-bis(phenylmethoxy)pentanamide |
|---|---|
| PubChem CID | 102342660 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | (2R,3R)-N-methoxy-N-methyl-4-oxo-2,3-bis(phenylmethoxy)pentanamide |
| SMILES | CON(C)C(=O)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)C(C)=O |
| InChI | InChI=1S/C21H25NO5/c1-16(23)19(26-14-17-10-6-4-7-11-17)20(21(24)22(2)25-3)27-15-18-12-8-5-9-13-18/h4-13,19-20H,14-15H2,1-3H3/t19-,20+/m0/s1 |
| InChIKey | SJYGNRFTGJETBM-VQTJNVASSA-N |
| XLogP | 2.77 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|