C22H23NO4 — CID 23628591
N-[(1S,5S,6R)-4-oxo-5,6-bis(phenylmethoxy)cyclohex-2-en-1-yl]acetamide (PubChem CID 23628591) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is N-[(1S,5S,6R)-4-oxo-5,6-bis(phenylmethoxy)cyclohex-2-en-1-yl]acetamide.
| Compound Name | N-[(1S,5S,6R)-4-oxo-5,6-bis(phenylmethoxy)cyclohex-2-en-1-yl]acetamide |
|---|---|
| PubChem CID | 23628591 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | N-[(1S,5S,6R)-4-oxo-5,6-bis(phenylmethoxy)cyclohex-2-en-1-yl]acetamide |
| SMILES | CC(=O)N[C@H]1C=CC(=O)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H23NO4/c1-16(24)23-19-12-13-20(25)22(27-15-18-10-6-3-7-11-18)21(19)26-14-17-8-4-2-5-9-17/h2-13,19,21-22H,14-15H2,1H3,(H,23,24)/t19-,21+,22+/m0/s1 |
| InChIKey | JOXJSRRQKZNBFY-KSEOMHKRSA-N |
| XLogP | 2.80 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |