C22H28N2O6 — CID 102342659
(2R,3R)-N,N'-dimethoxy-N,N'-dimethyl-2,3-bis(phenylmethoxy)butanediamide (PubChem CID 102342659) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is (2R,3R)-N,N'-dimethoxy-N,N'-dimethyl-2,3-bis(phenylmethoxy)butanediamide.
| Compound Name | (2R,3R)-N,N'-dimethoxy-N,N'-dimethyl-2,3-bis(phenylmethoxy)butanediamide |
|---|---|
| PubChem CID | 102342659 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | (2R,3R)-N,N'-dimethoxy-N,N'-dimethyl-2,3-bis(phenylmethoxy)butanediamide |
| SMILES | CON(C)C(=O)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)C(=O)N(C)OC |
| InChI | InChI=1S/C22H28N2O6/c1-23(27-3)21(25)19(29-15-17-11-7-5-8-12-17)20(22(26)24(2)28-4)30-16-18-13-9-6-10-14-18/h5-14,19-20H,15-16H2,1-4H3/t19-,20-/m1/s1 |
| InChIKey | DSSFZPUMTBPFEW-WOJBJXKFSA-N |
| XLogP | 2.20 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|