C26H27NO5 — CID 134837606
(2R,3R)-N-methoxy-N-methyl-4-oxo-4-phenyl-2,3-bis(phenylmethoxy)butanamide (PubChem CID 134837606) has the molecular formula C26H27NO5 and a molecular weight of 433.50 g/mol. Its IUPAC name is (2R,3R)-N-methoxy-N-methyl-4-oxo-4-phenyl-2,3-bis(phenylmethoxy)butanamide.
| Compound Name | (2R,3R)-N-methoxy-N-methyl-4-oxo-4-phenyl-2,3-bis(phenylmethoxy)butanamide |
|---|---|
| PubChem CID | 134837606 |
| Molecular Formula | C26H27NO5 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | (2R,3R)-N-methoxy-N-methyl-4-oxo-4-phenyl-2,3-bis(phenylmethoxy)butanamide |
| SMILES | CON(C)C(=O)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C26H27NO5/c1-27(30-2)26(29)25(32-19-21-14-8-4-9-15-21)24(23(28)22-16-10-5-11-17-22)31-18-20-12-6-3-7-13-20/h3-17,24-25H,18-19H2,1-2H3/t24-,25+/m0/s1 |
| InChIKey | WPSXRBNRRKOLEF-LOSJGSFVSA-N |
| XLogP | 4.06 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|