C16H22N2O5 — CID 134920624
(4R,5R)-2-methoxy-4-N,4-N,5-N,5-N-tetramethyl-2-phenyl-1,3-dioxolane-4,5-dicarboxamide (PubChem CID 134920624) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is (4R,5R)-2-methoxy-4-N,4-N,5-N,5-N-tetramethyl-2-phenyl-1,3-dioxolane-4,5-dicarboxamide.
| Compound Name | (4R,5R)-2-methoxy-4-N,4-N,5-N,5-N-tetramethyl-2-phenyl-1,3-dioxolane-4,5-dicarboxamide |
|---|---|
| PubChem CID | 134920624 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | (4R,5R)-2-methoxy-4-N,4-N,5-N,5-N-tetramethyl-2-phenyl-1,3-dioxolane-4,5-dicarboxamide |
| SMILES | COC1(c2ccccc2)O[C@@H](C(=O)N(C)C)[C@H](C(=O)N(C)C)O1 |
| InChI | InChI=1S/C16H22N2O5/c1-17(2)14(19)12-13(15(20)18(3)4)23-16(21-5,22-12)11-9-7-6-8-10-11/h6-10,12-13H,1-5H3/t12-,13-/m1/s1 |
| InChIKey | ZUPCEBTWCNSMCJ-CHWSQXEVSA-N |
| XLogP | 0.40 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |