C31H44F3NO3Si — CID 134970688
(2R)-3,3,3-trifluoro-2-methoxy-2-phenyl-1-[(2R)-2-[(S)-phenyl-tri(propan-2-yl)silyloxymethyl]piperidin-1-yl]propan-1-one (PubChem CID 134970688) has the molecular formula C31H44F3NO3Si and a molecular weight of 563.78 g/mol. Its IUPAC name is (2R)-3,3,3-trifluoro-2-methoxy-2-phenyl-1-[(2R)-2-[(S)-phenyl-tri(propan-2-yl)silyloxymethyl]piperidin-1-yl]propan-1-one.
| Compound Name | (2R)-3,3,3-trifluoro-2-methoxy-2-phenyl-1-[(2R)-2-[(S)-phenyl-tri(propan-2-yl)silyloxymethyl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 134970688 |
| Molecular Formula | C31H44F3NO3Si |
| Molecular Weight | 563.78 g/mol |
| Exact Mass | 563.30 |
| IUPAC Name | (2R)-3,3,3-trifluoro-2-methoxy-2-phenyl-1-[(2R)-2-[(S)-phenyl-tri(propan-2-yl)silyloxymethyl]piperidin-1-yl]propan-1-one |
| SMILES | CO[C@@](C(=O)N1CCCC[C@@H]1[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)c1ccccc1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C31H44F3NO3Si/c1-22(2)39(23(3)4,24(5)6)38-28(25-16-10-8-11-17-25)27-20-14-15-21-35(27)29(36)30(37-7,31(32,33)34)26-18-12-9-13-19-26/h8-13,16-19,22-24,27-28H,14-15,20-21H2,1-7H3/t27-,28+,30-/m1/s1 |
| InChIKey | JIKJQKJBFBHPFY-OYKXOOMRSA-N |
| XLogP | 8.41 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.78 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|