C29H43NO5Si — CID 132918951
methyl (2Z)-2-[8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-oxo-6-phenylmethoxy-5-prop-2-enyl-8-azabicyclo[3.2.1]octan-2-ylidene]propanoate (PubChem CID 132918951) has the molecular formula C29H43NO5Si and a molecular weight of 513.75 g/mol. Its IUPAC name is methyl (2Z)-2-[8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-oxo-6-phenylmethoxy-5-prop-2-enyl-8-azabicyclo[3.2.1]octan-2-ylidene]propanoate.
| Compound Name | methyl (2Z)-2-[8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-oxo-6-phenylmethoxy-5-prop-2-enyl-8-azabicyclo[3.2.1]octan-2-ylidene]propanoate |
|---|---|
| PubChem CID | 132918951 |
| Molecular Formula | C29H43NO5Si |
| Molecular Weight | 513.75 g/mol |
| Exact Mass | 513.29 |
| IUPAC Name | methyl (2Z)-2-[8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-oxo-6-phenylmethoxy-5-prop-2-enyl-8-azabicyclo[3.2.1]octan-2-ylidene]propanoate |
| SMILES | C=CCC12CC(=O)/C(=C(/C)C(=O)OC)C(CC1OCc1ccccc1)N2CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H43NO5Si/c1-9-15-29-19-24(31)26(21(2)27(32)33-6)23(18-25(29)34-20-22-13-11-10-12-14-22)30(29)16-17-35-36(7,8)28(3,4)5/h9-14,23,25H,1,15-20H2,2-8H3/b26-21- |
| InChIKey | NARKEUZEKFLTNP-QLYXXIJNSA-N |
| XLogP | 5.45 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.75 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|