C25H39NO3Si — CID 132918949
8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-phenylmethoxy-1-prop-2-enyl-8-azabicyclo[3.2.1]octan-3-one (PubChem CID 132918949) has the molecular formula C25H39NO3Si and a molecular weight of 429.68 g/mol. Its IUPAC name is 8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-phenylmethoxy-1-prop-2-enyl-8-azabicyclo[3.2.1]octan-3-one.
| Compound Name | 8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-phenylmethoxy-1-prop-2-enyl-8-azabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 132918949 |
| Molecular Formula | C25H39NO3Si |
| Molecular Weight | 429.68 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | 8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-phenylmethoxy-1-prop-2-enyl-8-azabicyclo[3.2.1]octan-3-one |
| SMILES | C=CCC12CC(=O)CC(CC1OCc1ccccc1)N2CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H39NO3Si/c1-7-13-25-18-22(27)16-21(17-23(25)28-19-20-11-9-8-10-12-20)26(25)14-15-29-30(5,6)24(2,3)4/h7-12,21,23H,1,13-19H2,2-6H3 |
| InChIKey | HPJCARMWEXAUGA-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.68 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|