C17H21NO2 — CID 11161579
(5R,8aS)-2-methylidene-5-(phenylmethoxymethyl)-1,3,5,6,8,8a-hexahydroindolizin-7-one (PubChem CID 11161579) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is (5R,8aS)-2-methylidene-5-(phenylmethoxymethyl)-1,3,5,6,8,8a-hexahydroindolizin-7-one.
| Compound Name | (5R,8aS)-2-methylidene-5-(phenylmethoxymethyl)-1,3,5,6,8,8a-hexahydroindolizin-7-one |
|---|---|
| PubChem CID | 11161579 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | (5R,8aS)-2-methylidene-5-(phenylmethoxymethyl)-1,3,5,6,8,8a-hexahydroindolizin-7-one |
| SMILES | C=C1C[C@H]2CC(=O)C[C@H](COCc3ccccc3)N2C1 |
| InChI | InChI=1S/C17H21NO2/c1-13-7-15-8-17(19)9-16(18(15)10-13)12-20-11-14-5-3-2-4-6-14/h2-6,15-16H,1,7-12H2/t15-,16+/m0/s1 |
| InChIKey | DEACOOYQAAMJED-JKSUJKDBSA-N |
| XLogP | 2.57 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|