C21H37NO4 — CID 91721604
dodecyl 3-methyl-2-(prop-2-ynoxycarbonylamino)butanoate (PubChem CID 91721604) has the molecular formula C21H37NO4 and a molecular weight of 367.53 g/mol. Its IUPAC name is dodecyl 3-methyl-2-(prop-2-ynoxycarbonylamino)butanoate.
| Compound Name | dodecyl 3-methyl-2-(prop-2-ynoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 91721604 |
| Molecular Formula | C21H37NO4 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.27 |
| IUPAC Name | dodecyl 3-methyl-2-(prop-2-ynoxycarbonylamino)butanoate |
| SMILES | C#CCOC(=O)NC(C(=O)OCCCCCCCCCCCC)C(C)C |
| InChI | InChI=1S/C21H37NO4/c1-5-7-8-9-10-11-12-13-14-15-17-25-20(23)19(18(3)4)22-21(24)26-16-6-2/h2,18-19H,5,7-17H2,1,3-4H3,(H,22,24) |
| InChIKey | ZJQIJYWNIHNBSX-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|