C17H31N — CID 91724382
3-hex-5-enyl-5-propyl-1,2,3,5,6,7,8,8a-octahydroindolizine (PubChem CID 91724382) has the molecular formula C17H31N and a molecular weight of 249.44 g/mol. Its IUPAC name is 3-hex-5-enyl-5-propyl-1,2,3,5,6,7,8,8a-octahydroindolizine.
| Compound Name | 3-hex-5-enyl-5-propyl-1,2,3,5,6,7,8,8a-octahydroindolizine |
|---|---|
| PubChem CID | 91724382 |
| Molecular Formula | C17H31N |
| Molecular Weight | 249.44 g/mol |
| Exact Mass | 249.25 |
| IUPAC Name | 3-hex-5-enyl-5-propyl-1,2,3,5,6,7,8,8a-octahydroindolizine |
| SMILES | C=CCCCCC1CCC2CCCC(CCC)N12 |
| InChI | InChI=1S/C17H31N/c1-3-5-6-7-10-16-13-14-17-12-8-11-15(9-4-2)18(16)17/h3,15-17H,1,4-14H2,2H3 |
| InChIKey | NJUJWPJFTSGFKK-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|