C26H51NO5Si4 — CID 91724399
[dimethyl(pyridin-2-ylmethoxy)silyl]oxy-[[dodec-9-ynoxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilane (PubChem CID 91724399) has the molecular formula C26H51NO5Si4 and a molecular weight of 570.04 g/mol. Its IUPAC name is [dimethyl(pyridin-2-ylmethoxy)silyl]oxy-[[dodec-9-ynoxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilane.
| Compound Name | [dimethyl(pyridin-2-ylmethoxy)silyl]oxy-[[dodec-9-ynoxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 91724399 |
| Molecular Formula | C26H51NO5Si4 |
| Molecular Weight | 570.04 g/mol |
| Exact Mass | 569.28 |
| IUPAC Name | [dimethyl(pyridin-2-ylmethoxy)silyl]oxy-[[dodec-9-ynoxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilane |
| SMILES | CCC#CCCCCCCCCO[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)OCc1ccccn1 |
| InChI | InChI=1S/C26H51NO5Si4/c1-10-11-12-13-14-15-16-17-18-21-24-28-33(2,3)30-35(6,7)32-36(8,9)31-34(4,5)29-25-26-22-19-20-23-27-26/h19-20,22-23H,10,13-18,21,24-25H2,1-9H3 |
| InChIKey | SOUGCKHCUPBBNW-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 59.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.04 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|