C20H33N3O6 — CID 91724919
butyl 2-[methyl-[2-[methyl-[2-[methyl(prop-2-ynoxycarbonyl)amino]propanoyl]amino]propanoyl]amino]propanoate (PubChem CID 91724919) has the molecular formula C20H33N3O6 and a molecular weight of 411.50 g/mol. Its IUPAC name is butyl 2-[methyl-[2-[methyl-[2-[methyl(prop-2-ynoxycarbonyl)amino]propanoyl]amino]propanoyl]amino]propanoate.
| Compound Name | butyl 2-[methyl-[2-[methyl-[2-[methyl(prop-2-ynoxycarbonyl)amino]propanoyl]amino]propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 91724919 |
| Molecular Formula | C20H33N3O6 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | butyl 2-[methyl-[2-[methyl-[2-[methyl(prop-2-ynoxycarbonyl)amino]propanoyl]amino]propanoyl]amino]propanoate |
| SMILES | C#CCOC(=O)N(C)C(C)C(=O)N(C)C(C)C(=O)N(C)C(C)C(=O)OCCCC |
| InChI | InChI=1S/C20H33N3O6/c1-9-11-13-28-19(26)16(5)22(7)17(24)14(3)21(6)18(25)15(4)23(8)20(27)29-12-10-2/h2,14-16H,9,11-13H2,1,3-8H3 |
| InChIKey | QHJBVJAIUQJCAP-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|