C21H33NO4 — CID 91725148
2-O-heptyl 6-O-(2-methylhexan-3-yl) pyridine-2,6-dicarboxylate (PubChem CID 91725148) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is 2-O-heptyl 6-O-(2-methylhexan-3-yl) pyridine-2,6-dicarboxylate.
| Compound Name | 2-O-heptyl 6-O-(2-methylhexan-3-yl) pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 91725148 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 2-O-heptyl 6-O-(2-methylhexan-3-yl) pyridine-2,6-dicarboxylate |
| SMILES | CCCCCCCOC(=O)c1cccc(C(=O)OC(CCC)C(C)C)n1 |
| InChI | InChI=1S/C21H33NO4/c1-5-7-8-9-10-15-25-20(23)17-13-11-14-18(22-17)21(24)26-19(12-6-2)16(3)4/h11,13-14,16,19H,5-10,12,15H2,1-4H3 |
| InChIKey | VAJSYITWTBHKDK-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|