C12H18N2O3 — CID 91725185
[1-(3-methoxypropyl)imidazol-2-yl]methyl 2-methylprop-2-enoate (PubChem CID 91725185) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is [1-(3-methoxypropyl)imidazol-2-yl]methyl 2-methylprop-2-enoate.
| Compound Name | [1-(3-methoxypropyl)imidazol-2-yl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 91725185 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | [1-(3-methoxypropyl)imidazol-2-yl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1nccn1CCCOC |
| InChI | InChI=1S/C12H18N2O3/c1-10(2)12(15)17-9-11-13-5-7-14(11)6-4-8-16-3/h5,7H,1,4,6,8-9H2,2-3H3 |
| InChIKey | LCRSKVCGWFFVDW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|