C15H32O3Si2 — CID 91726796
ethenyl-[ethenyl-methyl-(2-methylpropoxy)silyl]oxy-methyl-pentoxysilane (PubChem CID 91726796) has the molecular formula C15H32O3Si2 and a molecular weight of 316.59 g/mol. Its IUPAC name is ethenyl-[ethenyl-methyl-(2-methylpropoxy)silyl]oxy-methyl-pentoxysilane.
| Compound Name | ethenyl-[ethenyl-methyl-(2-methylpropoxy)silyl]oxy-methyl-pentoxysilane |
|---|---|
| PubChem CID | 91726796 |
| Molecular Formula | C15H32O3Si2 |
| Molecular Weight | 316.59 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | ethenyl-[ethenyl-methyl-(2-methylpropoxy)silyl]oxy-methyl-pentoxysilane |
| SMILES | C=C[Si](C)(OCCCCC)O[Si](C)(C=C)OCC(C)C |
| InChI | InChI=1S/C15H32O3Si2/c1-8-11-12-13-16-19(6,9-2)18-20(7,10-3)17-14-15(4)5/h9-10,15H,2-3,8,11-14H2,1,4-7H3 |
| InChIKey | ILBDXSBZOFZGIR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.59 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|