C22H46O3Si2 — CID 91726539
ethenyl-[ethenyl-methyl-(2,4,4-trimethylpentoxy)silyl]oxy-methyl-(2,4,4-trimethylpentoxy)silane (PubChem CID 91726539) has the molecular formula C22H46O3Si2 and a molecular weight of 414.78 g/mol. Its IUPAC name is ethenyl-[ethenyl-methyl-(2,4,4-trimethylpentoxy)silyl]oxy-methyl-(2,4,4-trimethylpentoxy)silane.
| Compound Name | ethenyl-[ethenyl-methyl-(2,4,4-trimethylpentoxy)silyl]oxy-methyl-(2,4,4-trimethylpentoxy)silane |
|---|---|
| PubChem CID | 91726539 |
| Molecular Formula | C22H46O3Si2 |
| Molecular Weight | 414.78 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | ethenyl-[ethenyl-methyl-(2,4,4-trimethylpentoxy)silyl]oxy-methyl-(2,4,4-trimethylpentoxy)silane |
| SMILES | C=C[Si](C)(OCC(C)CC(C)(C)C)O[Si](C)(C=C)OCC(C)CC(C)(C)C |
| InChI | InChI=1S/C22H46O3Si2/c1-13-26(11,23-17-19(3)15-21(5,6)7)25-27(12,14-2)24-18-20(4)16-22(8,9)10/h13-14,19-20H,1-2,15-18H2,3-12H3 |
| InChIKey | BOZWBARYJLYNSE-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.78 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|