C14H30O2Si — CID 91723174
ethenyl-methyl-propan-2-yloxy-(2,4,4-trimethylpentoxy)silane (PubChem CID 91723174) has the molecular formula C14H30O2Si and a molecular weight of 258.48 g/mol. Its IUPAC name is ethenyl-methyl-propan-2-yloxy-(2,4,4-trimethylpentoxy)silane.
| Compound Name | ethenyl-methyl-propan-2-yloxy-(2,4,4-trimethylpentoxy)silane |
|---|---|
| PubChem CID | 91723174 |
| Molecular Formula | C14H30O2Si |
| Molecular Weight | 258.48 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | ethenyl-methyl-propan-2-yloxy-(2,4,4-trimethylpentoxy)silane |
| SMILES | C=C[Si](C)(OCC(C)CC(C)(C)C)OC(C)C |
| InChI | InChI=1S/C14H30O2Si/c1-9-17(8,16-12(2)3)15-11-13(4)10-14(5,6)7/h9,12-13H,1,10-11H2,2-8H3 |
| InChIKey | FGJIUQFJIWIJHK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.48 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|