C13H28O2Si — CID 91708113
ethenyl-ethoxy-methyl-(2,4,4-trimethylpentoxy)silane (PubChem CID 91708113) has the molecular formula C13H28O2Si and a molecular weight of 244.45 g/mol. Its IUPAC name is ethenyl-ethoxy-methyl-(2,4,4-trimethylpentoxy)silane.
| Compound Name | ethenyl-ethoxy-methyl-(2,4,4-trimethylpentoxy)silane |
|---|---|
| PubChem CID | 91708113 |
| Molecular Formula | C13H28O2Si |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | ethenyl-ethoxy-methyl-(2,4,4-trimethylpentoxy)silane |
| SMILES | C=C[Si](C)(OCC)OCC(C)CC(C)(C)C |
| InChI | InChI=1S/C13H28O2Si/c1-8-14-16(7,9-2)15-11-12(3)10-13(4,5)6/h9,12H,2,8,10-11H2,1,3-7H3 |
| InChIKey | CZPYFSCTWVEOBO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|