C16H34O3Si2 — CID 91733146
ethenyl-(ethenyl-ethoxy-methylsilyl)oxy-methyl-(2,4,4-trimethylpentoxy)silane (PubChem CID 91733146) has the molecular formula C16H34O3Si2 and a molecular weight of 330.62 g/mol. Its IUPAC name is ethenyl-(ethenyl-ethoxy-methylsilyl)oxy-methyl-(2,4,4-trimethylpentoxy)silane.
| Compound Name | ethenyl-(ethenyl-ethoxy-methylsilyl)oxy-methyl-(2,4,4-trimethylpentoxy)silane |
|---|---|
| PubChem CID | 91733146 |
| Molecular Formula | C16H34O3Si2 |
| Molecular Weight | 330.62 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | ethenyl-(ethenyl-ethoxy-methylsilyl)oxy-methyl-(2,4,4-trimethylpentoxy)silane |
| SMILES | C=C[Si](C)(OCC)O[Si](C)(C=C)OCC(C)CC(C)(C)C |
| InChI | InChI=1S/C16H34O3Si2/c1-10-17-20(8,11-2)19-21(9,12-3)18-14-15(4)13-16(5,6)7/h11-12,15H,2-3,10,13-14H2,1,4-9H3 |
| InChIKey | GTQNDQXCEDXWGY-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.62 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|