C16H36O2Si — CID 91698395
3,3-dimethylbutan-2-yloxy-diethyl-(4-methylpentoxy)silane (PubChem CID 91698395) has the molecular formula C16H36O2Si and a molecular weight of 288.55 g/mol. Its IUPAC name is 3,3-dimethylbutan-2-yloxy-diethyl-(4-methylpentoxy)silane.
| Compound Name | 3,3-dimethylbutan-2-yloxy-diethyl-(4-methylpentoxy)silane |
|---|---|
| PubChem CID | 91698395 |
| Molecular Formula | C16H36O2Si |
| Molecular Weight | 288.55 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | 3,3-dimethylbutan-2-yloxy-diethyl-(4-methylpentoxy)silane |
| SMILES | CC[Si](CC)(OCCCC(C)C)OC(C)C(C)(C)C |
| InChI | InChI=1S/C16H36O2Si/c1-9-19(10-2,17-13-11-12-14(3)4)18-15(5)16(6,7)8/h14-15H,9-13H2,1-8H3 |
| InChIKey | JWDJHGYQYCCZOQ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.55 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|