C16H34O2Si — CID 91730083
ethenyl-methyl-pentoxy-(2,4,4-trimethylpentoxy)silane (PubChem CID 91730083) has the molecular formula C16H34O2Si and a molecular weight of 286.53 g/mol. Its IUPAC name is ethenyl-methyl-pentoxy-(2,4,4-trimethylpentoxy)silane.
| Compound Name | ethenyl-methyl-pentoxy-(2,4,4-trimethylpentoxy)silane |
|---|---|
| PubChem CID | 91730083 |
| Molecular Formula | C16H34O2Si |
| Molecular Weight | 286.53 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | ethenyl-methyl-pentoxy-(2,4,4-trimethylpentoxy)silane |
| SMILES | C=C[Si](C)(OCCCCC)OCC(C)CC(C)(C)C |
| InChI | InChI=1S/C16H34O2Si/c1-8-10-11-12-17-19(7,9-2)18-14-15(3)13-16(4,5)6/h9,15H,2,8,10-14H2,1,3-7H3 |
| InChIKey | HFGWUMPIGLRMHN-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|