C15H32O3Si2 — CID 91726805
butoxy-ethenyl-(ethenyl-methyl-pentoxysilyl)oxy-methylsilane (PubChem CID 91726805) has the molecular formula C15H32O3Si2 and a molecular weight of 316.59 g/mol. Its IUPAC name is butoxy-ethenyl-(ethenyl-methyl-pentoxysilyl)oxy-methylsilane.
| Compound Name | butoxy-ethenyl-(ethenyl-methyl-pentoxysilyl)oxy-methylsilane |
|---|---|
| PubChem CID | 91726805 |
| Molecular Formula | C15H32O3Si2 |
| Molecular Weight | 316.59 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | butoxy-ethenyl-(ethenyl-methyl-pentoxysilyl)oxy-methylsilane |
| SMILES | C=C[Si](C)(OCCCC)O[Si](C)(C=C)OCCCCC |
| InChI | InChI=1S/C15H32O3Si2/c1-7-11-13-15-17-20(6,10-4)18-19(5,9-3)16-14-12-8-2/h9-10H,3-4,7-8,11-15H2,1-2,5-6H3 |
| InChIKey | LTRKOEZAQUKYRQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.59 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|