About 4-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 1-O-propyl benzene-1,4-dicarboxylate
4-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 1-O-propyl benzene-1,4-dicarboxylate (PubChem CID 91727018) has the molecular formula C19H16F4O4
and a molecular weight of 384.33 g/mol. Its IUPAC name is 4-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 1-O-propyl benzene-1,4-dicarboxylate.
Molecular Properties
| Compound Name | 4-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 1-O-propyl benzene-1,4-dicarboxylate |
| PubChem CID | 91727018 |
| Molecular Formula | C19H16F4O4 |
| Molecular Weight | 384.33 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 4-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 1-O-propyl benzene-1,4-dicarboxylate |
| SMILES | CCCOC(=O)c1ccc(C(=O)OCc2c(F)cccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H16F4O4/c1-2-10-26-17(24)12-6-8-13(9-7-12)18(25)27-11-14-15(19(21,22)23)4-3-5-16(14)20/h3-9H,2,10-11H2,1H3 |
| InChIKey | DTQSTEKYSSRZKH-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.33 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 1-O-propyl benzene-1,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 1-O-propyl benzene-1,4-dicarboxylate?
The IUPAC name of 4-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 1-O-propyl benzene-1,4-dicarboxylate (CID 91727018) is 4-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 1-O-propyl benzene-1,4-dicarboxylate.
What is the SMILES notation for 4-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 1-O-propyl benzene-1,4-dicarboxylate?
The canonical SMILES for 4-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 1-O-propyl benzene-1,4-dicarboxylate is CCCOC(=O)c1ccc(C(=O)OCc2c(F)cccc2C(F)(F)F)cc1.
What is the InChIKey of 4-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 1-O-propyl benzene-1,4-dicarboxylate?
The InChIKey is DTQSTEKYSSRZKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16F4O4/c1-2-10-26-17(24)12-6-8-13(9-7-12)18(25)27-11-14-15(19(21,22)23)4-3-5-16(14)20/h3-9H,2,10-11H2,1H3.
What are the key properties of 4-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 1-O-propyl benzene-1,4-dicarboxylate?
4-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 1-O-propyl benzene-1,4-dicarboxylate has a molecular weight of 384.33 g/mol, XLogP of 4.77, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 1-O-propyl benzene-1,4-dicarboxylate is sourced from PubChem (CID 91727018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).