About 1-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 4-O-(2-methylpropyl) benzene-1,4-dicarboxylate
1-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 4-O-(2-methylpropyl) benzene-1,4-dicarboxylate (PubChem CID 91727144) has the molecular formula C20H18F4O4
and a molecular weight of 398.35 g/mol. Its IUPAC name is 1-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 4-O-(2-methylpropyl) benzene-1,4-dicarboxylate.
Molecular Properties
| Compound Name | 1-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 4-O-(2-methylpropyl) benzene-1,4-dicarboxylate |
| PubChem CID | 91727144 |
| Molecular Formula | C20H18F4O4 |
| Molecular Weight | 398.35 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 1-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 4-O-(2-methylpropyl) benzene-1,4-dicarboxylate |
| SMILES | CC(C)COC(=O)c1ccc(C(=O)OCc2c(F)cccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H18F4O4/c1-12(2)10-27-18(25)13-6-8-14(9-7-13)19(26)28-11-15-16(20(22,23)24)4-3-5-17(15)21/h3-9,12H,10-11H2,1-2H3 |
| InChIKey | AYOMEMHRFOATOW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.35 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 4-O-(2-methylpropyl) benzene-1,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 4-O-(2-methylpropyl) benzene-1,4-dicarboxylate?
The IUPAC name of 1-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 4-O-(2-methylpropyl) benzene-1,4-dicarboxylate (CID 91727144) is 1-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 4-O-(2-methylpropyl) benzene-1,4-dicarboxylate.
What is the SMILES notation for 1-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 4-O-(2-methylpropyl) benzene-1,4-dicarboxylate?
The canonical SMILES for 1-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 4-O-(2-methylpropyl) benzene-1,4-dicarboxylate is CC(C)COC(=O)c1ccc(C(=O)OCc2c(F)cccc2C(F)(F)F)cc1.
What is the InChIKey of 1-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 4-O-(2-methylpropyl) benzene-1,4-dicarboxylate?
The InChIKey is AYOMEMHRFOATOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18F4O4/c1-12(2)10-27-18(25)13-6-8-14(9-7-13)19(26)28-11-15-16(20(22,23)24)4-3-5-17(15)21/h3-9,12H,10-11H2,1-2H3.
What are the key properties of 1-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 4-O-(2-methylpropyl) benzene-1,4-dicarboxylate?
1-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 4-O-(2-methylpropyl) benzene-1,4-dicarboxylate has a molecular weight of 398.35 g/mol, XLogP of 5.01, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl] 4-O-(2-methylpropyl) benzene-1,4-dicarboxylate is sourced from PubChem (CID 91727144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).