C17H9F6NO3 — CID 91727530
(2,3,4,5,6-pentafluorophenyl)methyl (E)-4-(2-fluoroanilino)-4-oxobut-2-enoate (PubChem CID 91727530) has the molecular formula C17H9F6NO3 and a molecular weight of 389.25 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)methyl (E)-4-(2-fluoroanilino)-4-oxobut-2-enoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)methyl (E)-4-(2-fluoroanilino)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 91727530 |
| Molecular Formula | C17H9F6NO3 |
| Molecular Weight | 389.25 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)methyl (E)-4-(2-fluoroanilino)-4-oxobut-2-enoate |
| SMILES | O=C(/C=C/C(=O)OCc1c(F)c(F)c(F)c(F)c1F)Nc1ccccc1F |
| InChI | InChI=1S/C17H9F6NO3/c18-9-3-1-2-4-10(9)24-11(25)5-6-12(26)27-7-8-13(19)15(21)17(23)16(22)14(8)20/h1-6H,7H2,(H,24,25)/b6-5+ |
| InChIKey | TWIQGJNZRLXITI-AATRIKPKSA-N |
| XLogP | 3.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.25 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|