C21H18F6O6 — CID 91730298
5-(2,4,5-trifluoro-3-methoxybenzoyl)oxypentyl 2,4,5-trifluoro-3-methoxybenzoate (PubChem CID 91730298) has the molecular formula C21H18F6O6 and a molecular weight of 480.36 g/mol. Its IUPAC name is 5-(2,4,5-trifluoro-3-methoxybenzoyl)oxypentyl 2,4,5-trifluoro-3-methoxybenzoate.
| Compound Name | 5-(2,4,5-trifluoro-3-methoxybenzoyl)oxypentyl 2,4,5-trifluoro-3-methoxybenzoate |
|---|---|
| PubChem CID | 91730298 |
| Molecular Formula | C21H18F6O6 |
| Molecular Weight | 480.36 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | 5-(2,4,5-trifluoro-3-methoxybenzoyl)oxypentyl 2,4,5-trifluoro-3-methoxybenzoate |
| SMILES | COc1c(F)c(F)cc(C(=O)OCCCCCOC(=O)c2cc(F)c(F)c(OC)c2F)c1F |
| InChI | InChI=1S/C21H18F6O6/c1-30-18-14(24)10(8-12(22)16(18)26)20(28)32-6-4-3-5-7-33-21(29)11-9-13(23)17(27)19(31-2)15(11)25/h8-9H,3-7H2,1-2H3 |
| InChIKey | NXJMBHKJZGNOOI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.36 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|