About methyl 3-dodecoxybenzoate
methyl 3-dodecoxybenzoate (PubChem CID 5064578) has the molecular formula C20H32O3
and a molecular weight of 320.47 g/mol. Its IUPAC name is methyl 3-dodecoxybenzoate.
Molecular Properties
| Compound Name | methyl 3-dodecoxybenzoate |
| PubChem CID | 5064578 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | methyl 3-dodecoxybenzoate |
| SMILES | CCCCCCCCCCCCOc1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C20H32O3/c1-3-4-5-6-7-8-9-10-11-12-16-23-19-15-13-14-18(17-19)20(21)22-2/h13-15,17H,3-12,16H2,1-2H3 |
| InChIKey | JOYQSMXBQJIRSC-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-dodecoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-dodecoxybenzoate?
The IUPAC name of methyl 3-dodecoxybenzoate (CID 5064578) is methyl 3-dodecoxybenzoate.
What is the SMILES notation for methyl 3-dodecoxybenzoate?
The canonical SMILES for methyl 3-dodecoxybenzoate is CCCCCCCCCCCCOc1cccc(C(=O)OC)c1.
What is the InChIKey of methyl 3-dodecoxybenzoate?
The InChIKey is JOYQSMXBQJIRSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32O3/c1-3-4-5-6-7-8-9-10-11-12-16-23-19-15-13-14-18(17-19)20(21)22-2/h13-15,17H,3-12,16H2,1-2H3.
What are the key properties of methyl 3-dodecoxybenzoate?
methyl 3-dodecoxybenzoate has a molecular weight of 320.47 g/mol, XLogP of 5.77, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-dodecoxybenzoate is sourced from PubChem (CID 5064578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).