About tridecan-6-yl 4-fluoro-3-(trifluoromethyl)benzoate
tridecan-6-yl 4-fluoro-3-(trifluoromethyl)benzoate (PubChem CID 91731127) has the molecular formula C21H30F4O2
and a molecular weight of 390.46 g/mol. Its IUPAC name is tridecan-6-yl 4-fluoro-3-(trifluoromethyl)benzoate.
Molecular Properties
| Compound Name | tridecan-6-yl 4-fluoro-3-(trifluoromethyl)benzoate |
| PubChem CID | 91731127 |
| Molecular Formula | C21H30F4O2 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | tridecan-6-yl 4-fluoro-3-(trifluoromethyl)benzoate |
| SMILES | CCCCCCCC(CCCCC)OC(=O)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H30F4O2/c1-3-5-7-8-10-12-17(11-9-6-4-2)27-20(26)16-13-14-19(22)18(15-16)21(23,24)25/h13-15,17H,3-12H2,1-2H3 |
| InChIKey | ZPCXIXXVUVQFTH-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tridecan-6-yl 4-fluoro-3-(trifluoromethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tridecan-6-yl 4-fluoro-3-(trifluoromethyl)benzoate?
The IUPAC name of tridecan-6-yl 4-fluoro-3-(trifluoromethyl)benzoate (CID 91731127) is tridecan-6-yl 4-fluoro-3-(trifluoromethyl)benzoate.
What is the SMILES notation for tridecan-6-yl 4-fluoro-3-(trifluoromethyl)benzoate?
The canonical SMILES for tridecan-6-yl 4-fluoro-3-(trifluoromethyl)benzoate is CCCCCCCC(CCCCC)OC(=O)c1ccc(F)c(C(F)(F)F)c1.
What is the InChIKey of tridecan-6-yl 4-fluoro-3-(trifluoromethyl)benzoate?
The InChIKey is ZPCXIXXVUVQFTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30F4O2/c1-3-5-7-8-10-12-17(11-9-6-4-2)27-20(26)16-13-14-19(22)18(15-16)21(23,24)25/h13-15,17H,3-12H2,1-2H3.
What are the key properties of tridecan-6-yl 4-fluoro-3-(trifluoromethyl)benzoate?
tridecan-6-yl 4-fluoro-3-(trifluoromethyl)benzoate has a molecular weight of 390.46 g/mol, XLogP of 7.31, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tridecan-6-yl 4-fluoro-3-(trifluoromethyl)benzoate is sourced from PubChem (CID 91731127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).