C17H29N — CID 91731651
3-but-3-enyl-5-pent-4-enyl-1,2,3,5,6,7,8,8a-octahydroindolizine (PubChem CID 91731651) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is 3-but-3-enyl-5-pent-4-enyl-1,2,3,5,6,7,8,8a-octahydroindolizine.
| Compound Name | 3-but-3-enyl-5-pent-4-enyl-1,2,3,5,6,7,8,8a-octahydroindolizine |
|---|---|
| PubChem CID | 91731651 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | 3-but-3-enyl-5-pent-4-enyl-1,2,3,5,6,7,8,8a-octahydroindolizine |
| SMILES | C=CCCCC1CCCC2CCC(CCC=C)N12 |
| InChI | InChI=1S/C17H29N/c1-3-5-7-10-15-11-8-12-17-14-13-16(18(15)17)9-6-4-2/h3-4,15-17H,1-2,5-14H2 |
| InChIKey | YKXISQMZMSPXFZ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|