C24H25F3O2Si — CID 91732748
4-methylpentoxy-diphenyl-(2,3,4-trifluorophenoxy)silane (PubChem CID 91732748) has the molecular formula C24H25F3O2Si and a molecular weight of 430.54 g/mol. Its IUPAC name is 4-methylpentoxy-diphenyl-(2,3,4-trifluorophenoxy)silane.
| Compound Name | 4-methylpentoxy-diphenyl-(2,3,4-trifluorophenoxy)silane |
|---|---|
| PubChem CID | 91732748 |
| Molecular Formula | C24H25F3O2Si |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 4-methylpentoxy-diphenyl-(2,3,4-trifluorophenoxy)silane |
| SMILES | CC(C)CCCO[Si](Oc1ccc(F)c(F)c1F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H25F3O2Si/c1-18(2)10-9-17-28-30(19-11-5-3-6-12-19,20-13-7-4-8-14-20)29-22-16-15-21(25)23(26)24(22)27/h3-8,11-16,18H,9-10,17H2,1-2H3 |
| InChIKey | NEFKEFANZJGFTQ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|