C29H34F4O2Si — CID 91732651
decoxy-[2-fluoro-3-(trifluoromethyl)phenoxy]-diphenylsilane (PubChem CID 91732651) has the molecular formula C29H34F4O2Si and a molecular weight of 518.67 g/mol. Its IUPAC name is decoxy-[2-fluoro-3-(trifluoromethyl)phenoxy]-diphenylsilane.
| Compound Name | decoxy-[2-fluoro-3-(trifluoromethyl)phenoxy]-diphenylsilane |
|---|---|
| PubChem CID | 91732651 |
| Molecular Formula | C29H34F4O2Si |
| Molecular Weight | 518.67 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | decoxy-[2-fluoro-3-(trifluoromethyl)phenoxy]-diphenylsilane |
| SMILES | CCCCCCCCCCO[Si](Oc1cccc(C(F)(F)F)c1F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H34F4O2Si/c1-2-3-4-5-6-7-8-15-23-34-36(24-17-11-9-12-18-24,25-19-13-10-14-20-25)35-27-22-16-21-26(28(27)30)29(31,32)33/h9-14,16-22H,2-8,15,23H2,1H3 |
| InChIKey | BIGJEYPHOOZYCG-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.67 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|