C27H43NO2Si2 — CID 91733227
[2-(4-benzylpiperidin-1-yl)-1-(4-trimethylsilyloxyphenyl)propoxy]-trimethylsilane (PubChem CID 91733227) has the molecular formula C27H43NO2Si2 and a molecular weight of 469.82 g/mol. Its IUPAC name is [2-(4-benzylpiperidin-1-yl)-1-(4-trimethylsilyloxyphenyl)propoxy]-trimethylsilane.
| Compound Name | [2-(4-benzylpiperidin-1-yl)-1-(4-trimethylsilyloxyphenyl)propoxy]-trimethylsilane |
|---|---|
| PubChem CID | 91733227 |
| Molecular Formula | C27H43NO2Si2 |
| Molecular Weight | 469.82 g/mol |
| Exact Mass | 469.28 |
| IUPAC Name | [2-(4-benzylpiperidin-1-yl)-1-(4-trimethylsilyloxyphenyl)propoxy]-trimethylsilane |
| SMILES | CC(C(O[Si](C)(C)C)c1ccc(O[Si](C)(C)C)cc1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H43NO2Si2/c1-22(28-19-17-24(18-20-28)21-23-11-9-8-10-12-23)27(30-32(5,6)7)25-13-15-26(16-14-25)29-31(2,3)4/h8-16,22,24,27H,17-21H2,1-7H3 |
| InChIKey | RWEDHGPTWKQGME-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.82 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|