C28H37N — CID 178044115
4-benzyl-1-[3-[4-(2-methylidenebutyl)phenyl]pent-4-en-2-yl]piperidine (PubChem CID 178044115) has the molecular formula C28H37N and a molecular weight of 387.61 g/mol. Its IUPAC name is 4-benzyl-1-[3-[4-(2-methylidenebutyl)phenyl]pent-4-en-2-yl]piperidine.
| Compound Name | 4-benzyl-1-[3-[4-(2-methylidenebutyl)phenyl]pent-4-en-2-yl]piperidine |
|---|---|
| PubChem CID | 178044115 |
| Molecular Formula | C28H37N |
| Molecular Weight | 387.61 g/mol |
| Exact Mass | 387.29 |
| IUPAC Name | 4-benzyl-1-[3-[4-(2-methylidenebutyl)phenyl]pent-4-en-2-yl]piperidine |
| SMILES | C=CC(c1ccc(CC(=C)CC)cc1)C(C)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C28H37N/c1-5-22(3)20-25-12-14-27(15-13-25)28(6-2)23(4)29-18-16-26(17-19-29)21-24-10-8-7-9-11-24/h6-15,23,26,28H,2-3,5,16-21H2,1,4H3 |
| InChIKey | YGVMGKCUEFMTBL-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.61 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|