C14H20F4O4 — CID 91734881
4-O-(1-cyclopentylethyl) 1-O-(2,2,3,3-tetrafluoropropyl) butanedioate (PubChem CID 91734881) has the molecular formula C14H20F4O4 and a molecular weight of 328.30 g/mol. Its IUPAC name is 4-O-(1-cyclopentylethyl) 1-O-(2,2,3,3-tetrafluoropropyl) butanedioate.
| Compound Name | 4-O-(1-cyclopentylethyl) 1-O-(2,2,3,3-tetrafluoropropyl) butanedioate |
|---|---|
| PubChem CID | 91734881 |
| Molecular Formula | C14H20F4O4 |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 4-O-(1-cyclopentylethyl) 1-O-(2,2,3,3-tetrafluoropropyl) butanedioate |
| SMILES | CC(OC(=O)CCC(=O)OCC(F)(F)C(F)F)C1CCCC1 |
| InChI | InChI=1S/C14H20F4O4/c1-9(10-4-2-3-5-10)22-12(20)7-6-11(19)21-8-14(17,18)13(15)16/h9-10,13H,2-8H2,1H3 |
| InChIKey | FJGLZRSBFSMVDW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|