C21H34F4O4 — CID 91734921
1-O-[(E)-tetradec-3-enyl] 4-O-(2,2,3,3-tetrafluoropropyl) butanedioate (PubChem CID 91734921) has the molecular formula C21H34F4O4 and a molecular weight of 426.49 g/mol. Its IUPAC name is 1-O-[(E)-tetradec-3-enyl] 4-O-(2,2,3,3-tetrafluoropropyl) butanedioate.
| Compound Name | 1-O-[(E)-tetradec-3-enyl] 4-O-(2,2,3,3-tetrafluoropropyl) butanedioate |
|---|---|
| PubChem CID | 91734921 |
| Molecular Formula | C21H34F4O4 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 1-O-[(E)-tetradec-3-enyl] 4-O-(2,2,3,3-tetrafluoropropyl) butanedioate |
| SMILES | CCCCCCCCCC/C=C/CCOC(=O)CCC(=O)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C21H34F4O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-28-18(26)14-15-19(27)29-17-21(24,25)20(22)23/h11-12,20H,2-10,13-17H2,1H3/b12-11+ |
| InChIKey | AVKPCYQYQDWABM-VAWYXSNFSA-N |
| XLogP | 6.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|