C14H30O2Si — CID 91734977
butoxy-(2,4-dimethylpentan-3-yloxy)-ethenyl-methylsilane (PubChem CID 91734977) has the molecular formula C14H30O2Si and a molecular weight of 258.48 g/mol. Its IUPAC name is butoxy-(2,4-dimethylpentan-3-yloxy)-ethenyl-methylsilane.
| Compound Name | butoxy-(2,4-dimethylpentan-3-yloxy)-ethenyl-methylsilane |
|---|---|
| PubChem CID | 91734977 |
| Molecular Formula | C14H30O2Si |
| Molecular Weight | 258.48 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | butoxy-(2,4-dimethylpentan-3-yloxy)-ethenyl-methylsilane |
| SMILES | C=C[Si](C)(OCCCC)OC(C(C)C)C(C)C |
| InChI | InChI=1S/C14H30O2Si/c1-8-10-11-15-17(7,9-2)16-14(12(3)4)13(5)6/h9,12-14H,2,8,10-11H2,1,3-7H3 |
| InChIKey | DCGYCANAFWUUHC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.48 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|