C17H36O3Si2 — CID 91735020
ethenyl-[ethenyl-(2-ethylhexoxy)-methylsilyl]oxy-methyl-propoxysilane (PubChem CID 91735020) has the molecular formula C17H36O3Si2 and a molecular weight of 344.64 g/mol. Its IUPAC name is ethenyl-[ethenyl-(2-ethylhexoxy)-methylsilyl]oxy-methyl-propoxysilane.
| Compound Name | ethenyl-[ethenyl-(2-ethylhexoxy)-methylsilyl]oxy-methyl-propoxysilane |
|---|---|
| PubChem CID | 91735020 |
| Molecular Formula | C17H36O3Si2 |
| Molecular Weight | 344.64 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | ethenyl-[ethenyl-(2-ethylhexoxy)-methylsilyl]oxy-methyl-propoxysilane |
| SMILES | C=C[Si](C)(OCCC)O[Si](C)(C=C)OCC(CC)CCCC |
| InChI | InChI=1S/C17H36O3Si2/c1-8-13-14-17(10-3)16-19-22(7,12-5)20-21(6,11-4)18-15-9-2/h11-12,17H,4-5,8-10,13-16H2,1-3,6-7H3 |
| InChIKey | YYAGFDRYIHFDKW-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.64 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|