C14H22F5NO3 — CID 91735318
hexyl 3-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate (PubChem CID 91735318) has the molecular formula C14H22F5NO3 and a molecular weight of 347.32 g/mol. Its IUPAC name is hexyl 3-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate.
| Compound Name | hexyl 3-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate |
|---|---|
| PubChem CID | 91735318 |
| Molecular Formula | C14H22F5NO3 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | hexyl 3-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate |
| SMILES | CCCCCCOC(=O)C(NC(=O)C(F)(F)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C14H22F5NO3/c1-4-5-6-7-8-23-11(21)10(9(2)3)20-12(22)13(15,16)14(17,18)19/h9-10H,4-8H2,1-3H3,(H,20,22) |
| InChIKey | QLCUAQBNERQVAA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|