C17H13F3O — CID 91735710
9-[(1R)-2,2,2-trifluoro-1-methoxyethyl]anthracene (PubChem CID 91735710) has the molecular formula C17H13F3O and a molecular weight of 290.28 g/mol. Its IUPAC name is 9-[(1R)-2,2,2-trifluoro-1-methoxyethyl]anthracene.
| Compound Name | 9-[(1R)-2,2,2-trifluoro-1-methoxyethyl]anthracene |
|---|---|
| PubChem CID | 91735710 |
| Molecular Formula | C17H13F3O |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 9-[(1R)-2,2,2-trifluoro-1-methoxyethyl]anthracene |
| SMILES | CO[C@H](c1c2ccccc2cc2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C17H13F3O/c1-21-16(17(18,19)20)15-13-8-4-2-6-11(13)10-12-7-3-5-9-14(12)15/h2-10,16H,1H3/t16-/m1/s1 |
| InChIKey | RLRMJMUQHVGSEW-MRXNPFEDSA-N |
| XLogP | 5.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|