C17H36O3Si2 — CID 91736540
butoxy-ethenyl-(ethenyl-heptan-2-yloxy-methylsilyl)oxy-methylsilane (PubChem CID 91736540) has the molecular formula C17H36O3Si2 and a molecular weight of 344.64 g/mol. Its IUPAC name is butoxy-ethenyl-(ethenyl-heptan-2-yloxy-methylsilyl)oxy-methylsilane.
| Compound Name | butoxy-ethenyl-(ethenyl-heptan-2-yloxy-methylsilyl)oxy-methylsilane |
|---|---|
| PubChem CID | 91736540 |
| Molecular Formula | C17H36O3Si2 |
| Molecular Weight | 344.64 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | butoxy-ethenyl-(ethenyl-heptan-2-yloxy-methylsilyl)oxy-methylsilane |
| SMILES | C=C[Si](C)(OCCCC)O[Si](C)(C=C)OC(C)CCCCC |
| InChI | InChI=1S/C17H36O3Si2/c1-8-12-14-15-17(5)19-22(7,11-4)20-21(6,10-3)18-16-13-9-2/h10-11,17H,3-4,8-9,12-16H2,1-2,5-7H3 |
| InChIKey | JQHCLHRNLSGMFA-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.64 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|