C26H56O3Si2 — CID 91738308
trimethylsilyl 3,7,11,15-tetramethyl-3-trimethylsilyloxyhexadecanoate (PubChem CID 91738308) has the molecular formula C26H56O3Si2 and a molecular weight of 472.90 g/mol. Its IUPAC name is trimethylsilyl 3,7,11,15-tetramethyl-3-trimethylsilyloxyhexadecanoate.
| Compound Name | trimethylsilyl 3,7,11,15-tetramethyl-3-trimethylsilyloxyhexadecanoate |
|---|---|
| PubChem CID | 91738308 |
| Molecular Formula | C26H56O3Si2 |
| Molecular Weight | 472.90 g/mol |
| Exact Mass | 472.38 |
| IUPAC Name | trimethylsilyl 3,7,11,15-tetramethyl-3-trimethylsilyloxyhexadecanoate |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)(CC(=O)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C26H56O3Si2/c1-22(2)15-12-16-23(3)17-13-18-24(4)19-14-20-26(5,29-31(9,10)11)21-25(27)28-30(6,7)8/h22-24H,12-21H2,1-11H3 |
| InChIKey | NRUYEYALIOBZJE-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.90 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|