C19H40O3Si2 — CID 91739083
ethenyl-(ethenyl-heptan-2-yloxy-methylsilyl)oxy-hexoxy-methylsilane (PubChem CID 91739083) has the molecular formula C19H40O3Si2 and a molecular weight of 372.70 g/mol. Its IUPAC name is ethenyl-(ethenyl-heptan-2-yloxy-methylsilyl)oxy-hexoxy-methylsilane.
| Compound Name | ethenyl-(ethenyl-heptan-2-yloxy-methylsilyl)oxy-hexoxy-methylsilane |
|---|---|
| PubChem CID | 91739083 |
| Molecular Formula | C19H40O3Si2 |
| Molecular Weight | 372.70 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | ethenyl-(ethenyl-heptan-2-yloxy-methylsilyl)oxy-hexoxy-methylsilane |
| SMILES | C=C[Si](C)(OCCCCCC)O[Si](C)(C=C)OC(C)CCCCC |
| InChI | InChI=1S/C19H40O3Si2/c1-8-12-14-16-18-20-23(6,10-3)22-24(7,11-4)21-19(5)17-15-13-9-2/h10-11,19H,3-4,8-9,12-18H2,1-2,5-7H3 |
| InChIKey | PMZHLBHHDJKMIX-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.70 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|