C25H32O5 — CID 91739473
1-O-octyl 3-O-(2-propan-2-yloxyphenyl) benzene-1,3-dicarboxylate (PubChem CID 91739473) has the molecular formula C25H32O5 and a molecular weight of 412.53 g/mol. Its IUPAC name is 1-O-octyl 3-O-(2-propan-2-yloxyphenyl) benzene-1,3-dicarboxylate.
| Compound Name | 1-O-octyl 3-O-(2-propan-2-yloxyphenyl) benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 91739473 |
| Molecular Formula | C25H32O5 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 1-O-octyl 3-O-(2-propan-2-yloxyphenyl) benzene-1,3-dicarboxylate |
| SMILES | CCCCCCCCOC(=O)c1cccc(C(=O)Oc2ccccc2OC(C)C)c1 |
| InChI | InChI=1S/C25H32O5/c1-4-5-6-7-8-11-17-28-24(26)20-13-12-14-21(18-20)25(27)30-23-16-10-9-15-22(23)29-19(2)3/h9-10,12-16,18-19H,4-8,11,17H2,1-3H3 |
| InChIKey | UDBOJJAWJINVCQ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|