C14H10F10N2O2 — CID 91739757
2,2,3,3,3-pentafluoro-N-[[4-[(2,2,3,3,3-pentafluoropropanoylamino)methyl]phenyl]methyl]propanamide (PubChem CID 91739757) has the molecular formula C14H10F10N2O2 and a molecular weight of 428.23 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-[[4-[(2,2,3,3,3-pentafluoropropanoylamino)methyl]phenyl]methyl]propanamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N-[[4-[(2,2,3,3,3-pentafluoropropanoylamino)methyl]phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 91739757 |
| Molecular Formula | C14H10F10N2O2 |
| Molecular Weight | 428.23 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-[[4-[(2,2,3,3,3-pentafluoropropanoylamino)methyl]phenyl]methyl]propanamide |
| SMILES | O=C(NCc1ccc(CNC(=O)C(F)(F)C(F)(F)F)cc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H10F10N2O2/c15-11(16,13(19,20)21)9(27)25-5-7-1-2-8(4-3-7)6-26-10(28)12(17,18)14(22,23)24/h1-4H,5-6H2,(H,25,27)(H,26,28) |
| InChIKey | RXLFOHGGELIAAR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.23 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|