C15H26O4Si — CID 91740000
(2,6-dimethoxyphenoxy)-dimethyl-pentoxysilane (PubChem CID 91740000) has the molecular formula C15H26O4Si and a molecular weight of 298.45 g/mol. Its IUPAC name is (2,6-dimethoxyphenoxy)-dimethyl-pentoxysilane.
| Compound Name | (2,6-dimethoxyphenoxy)-dimethyl-pentoxysilane |
|---|---|
| PubChem CID | 91740000 |
| Molecular Formula | C15H26O4Si |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (2,6-dimethoxyphenoxy)-dimethyl-pentoxysilane |
| SMILES | CCCCCO[Si](C)(C)Oc1c(OC)cccc1OC |
| InChI | InChI=1S/C15H26O4Si/c1-6-7-8-12-18-20(4,5)19-15-13(16-2)10-9-11-14(15)17-3/h9-11H,6-8,12H2,1-5H3 |
| InChIKey | ANGRRPZSODIMSY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|