C14H24O2Si — CID 91738660
butoxy-(2,3-dimethylphenoxy)-dimethylsilane (PubChem CID 91738660) has the molecular formula C14H24O2Si and a molecular weight of 252.43 g/mol. Its IUPAC name is butoxy-(2,3-dimethylphenoxy)-dimethylsilane.
| Compound Name | butoxy-(2,3-dimethylphenoxy)-dimethylsilane |
|---|---|
| PubChem CID | 91738660 |
| Molecular Formula | C14H24O2Si |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | butoxy-(2,3-dimethylphenoxy)-dimethylsilane |
| SMILES | CCCCO[Si](C)(C)Oc1cccc(C)c1C |
| InChI | InChI=1S/C14H24O2Si/c1-6-7-11-15-17(4,5)16-14-10-8-9-12(2)13(14)3/h8-10H,6-7,11H2,1-5H3 |
| InChIKey | YJKSZGQWCFFJAQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|